About 1-(3,4-dimethoxyphenyl)-N,4-diphenylazetidin-2-imine
1-(3,4-dimethoxyphenyl)-N,4-diphenylazetidin-2-imine (PubChem CID 126702798) has the molecular formula C23H22N2O2
and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N,4-diphenylazetidin-2-imine.
Molecular Properties
| Compound Name | 1-(3,4-dimethoxyphenyl)-N,4-diphenylazetidin-2-imine |
| PubChem CID | 126702798 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N,4-diphenylazetidin-2-imine |
| SMILES | COc1ccc(N2/C(=N/c3ccccc3)CC2c2ccccc2)cc1OC |
| InChI | InChI=1S/C23H22N2O2/c1-26-21-14-13-19(15-22(21)27-2)25-20(17-9-5-3-6-10-17)16-23(25)24-18-11-7-4-8-12-18/h3-15,20H,16H2,1-2H3/b24-23+ |
| InChIKey | YLPPWLBHINTHQI-WCWDXBQESA-N |
| XLogP | 5.39 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dimethoxyphenyl)-N,4-diphenylazetidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethoxyphenyl)-N,4-diphenylazetidin-2-imine?
The IUPAC name of 1-(3,4-dimethoxyphenyl)-N,4-diphenylazetidin-2-imine (CID 126702798) is 1-(3,4-dimethoxyphenyl)-N,4-diphenylazetidin-2-imine.
What is the SMILES notation for 1-(3,4-dimethoxyphenyl)-N,4-diphenylazetidin-2-imine?
The canonical SMILES for 1-(3,4-dimethoxyphenyl)-N,4-diphenylazetidin-2-imine is COc1ccc(N2/C(=N/c3ccccc3)CC2c2ccccc2)cc1OC.
What is the InChIKey of 1-(3,4-dimethoxyphenyl)-N,4-diphenylazetidin-2-imine?
The InChIKey is YLPPWLBHINTHQI-WCWDXBQESA-N. The full InChI is InChI=1S/C23H22N2O2/c1-26-21-14-13-19(15-22(21)27-2)25-20(17-9-5-3-6-10-17)16-23(25)24-18-11-7-4-8-12-18/h3-15,20H,16H2,1-2H3/b24-23+.
What are the key properties of 1-(3,4-dimethoxyphenyl)-N,4-diphenylazetidin-2-imine?
1-(3,4-dimethoxyphenyl)-N,4-diphenylazetidin-2-imine has a molecular weight of 358.44 g/mol, XLogP of 5.39, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethoxyphenyl)-N,4-diphenylazetidin-2-imine is sourced from PubChem (CID 126702798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).