About 1-(1,3-benzodioxol-5-yl)-N,4-diphenylazetidin-2-imine
1-(1,3-benzodioxol-5-yl)-N,4-diphenylazetidin-2-imine (PubChem CID 126702801) has the molecular formula C22H18N2O2
and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N,4-diphenylazetidin-2-imine.
Molecular Properties
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N,4-diphenylazetidin-2-imine |
| PubChem CID | 126702801 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N,4-diphenylazetidin-2-imine |
| SMILES | c1ccc(/N=C2\CC(c3ccccc3)N2c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C22H18N2O2/c1-3-7-16(8-4-1)19-14-22(23-17-9-5-2-6-10-17)24(19)18-11-12-20-21(13-18)26-15-25-20/h1-13,19H,14-15H2/b23-22+ |
| InChIKey | XVEGCVBUDQWBKA-GHVJWSGMSA-N |
| XLogP | 5.10 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,3-benzodioxol-5-yl)-N,4-diphenylazetidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzodioxol-5-yl)-N,4-diphenylazetidin-2-imine?
The IUPAC name of 1-(1,3-benzodioxol-5-yl)-N,4-diphenylazetidin-2-imine (CID 126702801) is 1-(1,3-benzodioxol-5-yl)-N,4-diphenylazetidin-2-imine.
What is the SMILES notation for 1-(1,3-benzodioxol-5-yl)-N,4-diphenylazetidin-2-imine?
The canonical SMILES for 1-(1,3-benzodioxol-5-yl)-N,4-diphenylazetidin-2-imine is c1ccc(/N=C2\CC(c3ccccc3)N2c2ccc3c(c2)OCO3)cc1.
What is the InChIKey of 1-(1,3-benzodioxol-5-yl)-N,4-diphenylazetidin-2-imine?
The InChIKey is XVEGCVBUDQWBKA-GHVJWSGMSA-N. The full InChI is InChI=1S/C22H18N2O2/c1-3-7-16(8-4-1)19-14-22(23-17-9-5-2-6-10-17)24(19)18-11-12-20-21(13-18)26-15-25-20/h1-13,19H,14-15H2/b23-22+.
What are the key properties of 1-(1,3-benzodioxol-5-yl)-N,4-diphenylazetidin-2-imine?
1-(1,3-benzodioxol-5-yl)-N,4-diphenylazetidin-2-imine has a molecular weight of 342.40 g/mol, XLogP of 5.10, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzodioxol-5-yl)-N,4-diphenylazetidin-2-imine is sourced from PubChem (CID 126702801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).