About (2S)-1-[(2E)-penta-2,4-dien-2-yl]oxypropan-2-amine
(2S)-1-[(2E)-penta-2,4-dien-2-yl]oxypropan-2-amine (PubChem CID 126703032) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is (2S)-1-[(2E)-penta-2,4-dien-2-yl]oxypropan-2-amine.
Molecular Properties
| Compound Name | (2S)-1-[(2E)-penta-2,4-dien-2-yl]oxypropan-2-amine |
| PubChem CID | 126703032 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (2S)-1-[(2E)-penta-2,4-dien-2-yl]oxypropan-2-amine |
| SMILES | C=C/C=C(\C)OC[C@H](C)N |
| InChI | InChI=1S/C8H15NO/c1-4-5-8(3)10-6-7(2)9/h4-5,7H,1,6,9H2,2-3H3/b8-5+/t7-/m0/s1 |
| InChIKey | YBJROMFFUKDQQW-QAZRXNLGSA-N |
| XLogP | 1.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1-[(2E)-penta-2,4-dien-2-yl]oxypropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[(2E)-penta-2,4-dien-2-yl]oxypropan-2-amine?
The IUPAC name of (2S)-1-[(2E)-penta-2,4-dien-2-yl]oxypropan-2-amine (CID 126703032) is (2S)-1-[(2E)-penta-2,4-dien-2-yl]oxypropan-2-amine.
What is the SMILES notation for (2S)-1-[(2E)-penta-2,4-dien-2-yl]oxypropan-2-amine?
The canonical SMILES for (2S)-1-[(2E)-penta-2,4-dien-2-yl]oxypropan-2-amine is C=C/C=C(\C)OC[C@H](C)N.
What is the InChIKey of (2S)-1-[(2E)-penta-2,4-dien-2-yl]oxypropan-2-amine?
The InChIKey is YBJROMFFUKDQQW-QAZRXNLGSA-N. The full InChI is InChI=1S/C8H15NO/c1-4-5-8(3)10-6-7(2)9/h4-5,7H,1,6,9H2,2-3H3/b8-5+/t7-/m0/s1.
What are the key properties of (2S)-1-[(2E)-penta-2,4-dien-2-yl]oxypropan-2-amine?
(2S)-1-[(2E)-penta-2,4-dien-2-yl]oxypropan-2-amine has a molecular weight of 141.21 g/mol, XLogP of 1.44, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[(2E)-penta-2,4-dien-2-yl]oxypropan-2-amine is sourced from PubChem (CID 126703032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).