About 5-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-5-yl)-1,3-benzoxazole
5-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-5-yl)-1,3-benzoxazole (PubChem CID 126703143) has the molecular formula C21H12N4OS
and a molecular weight of 368.42 g/mol. Its IUPAC name is 5-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-5-yl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 5-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-5-yl)-1,3-benzoxazole |
| PubChem CID | 126703143 |
| Molecular Formula | C21H12N4OS |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 5-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-5-yl)-1,3-benzoxazole |
| SMILES | c1ccc2[nH]c(-c3ccc4oc(-c5ccc6scnc6c5)nc4c3)nc2c1 |
| InChI | InChI=1S/C21H12N4OS/c1-2-4-15-14(3-1)23-20(24-15)12-5-7-18-16(9-12)25-21(26-18)13-6-8-19-17(10-13)22-11-27-19/h1-11H,(H,23,24) |
| InChIKey | LPMDBOIRRGOWDX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-5-yl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-5-yl)-1,3-benzoxazole?
The IUPAC name of 5-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-5-yl)-1,3-benzoxazole (CID 126703143) is 5-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-5-yl)-1,3-benzoxazole.
What is the SMILES notation for 5-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-5-yl)-1,3-benzoxazole?
The canonical SMILES for 5-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-5-yl)-1,3-benzoxazole is c1ccc2[nH]c(-c3ccc4oc(-c5ccc6scnc6c5)nc4c3)nc2c1.
What is the InChIKey of 5-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-5-yl)-1,3-benzoxazole?
The InChIKey is LPMDBOIRRGOWDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12N4OS/c1-2-4-15-14(3-1)23-20(24-15)12-5-7-18-16(9-12)25-21(26-18)13-6-8-19-17(10-13)22-11-27-19/h1-11H,(H,23,24).
What are the key properties of 5-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-5-yl)-1,3-benzoxazole?
5-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-5-yl)-1,3-benzoxazole has a molecular weight of 368.42 g/mol, XLogP of 5.65, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1H-benzimidazol-2-yl)-2-(1,3-benzothiazol-5-yl)-1,3-benzoxazole is sourced from PubChem (CID 126703143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).