C25H40FN3 — CID 126703336
(3R)-2-[6-[(Z)-1-fluoro-2-[(Z)-prop-1-enyl]hex-4-enyl]-2-methyl-4,5,6,7-tetrahydroisoindol-4-yl]-N,1,2,4-tetramethylazetidin-3-amine (PubChem CID 126703336) has the molecular formula C25H40FN3 and a molecular weight of 401.61 g/mol. Its IUPAC name is (3R)-2-[6-[(Z)-1-fluoro-2-[(Z)-prop-1-enyl]hex-4-enyl]-2-methyl-4,5,6,7-tetrahydroisoindol-4-yl]-N,1,2,4-tetramethylazetidin-3-amine.
| Compound Name | (3R)-2-[6-[(Z)-1-fluoro-2-[(Z)-prop-1-enyl]hex-4-enyl]-2-methyl-4,5,6,7-tetrahydroisoindol-4-yl]-N,1,2,4-tetramethylazetidin-3-amine |
|---|---|
| PubChem CID | 126703336 |
| Molecular Formula | C25H40FN3 |
| Molecular Weight | 401.61 g/mol |
| Exact Mass | 401.32 |
| IUPAC Name | (3R)-2-[6-[(Z)-1-fluoro-2-[(Z)-prop-1-enyl]hex-4-enyl]-2-methyl-4,5,6,7-tetrahydroisoindol-4-yl]-N,1,2,4-tetramethylazetidin-3-amine |
| SMILES | C/C=C\CC(/C=C\C)C(F)C1Cc2cn(C)cc2C(C2(C)[C@H](NC)C(C)N2C)C1 |
| InChI | InChI=1S/C25H40FN3/c1-8-10-12-18(11-9-2)23(26)19-13-20-15-28(6)16-21(20)22(14-19)25(4)24(27-5)17(3)29(25)7/h8-11,15-19,22-24,27H,12-14H2,1-7H3/b10-8-,11-9-/t17?,18?,19?,22?,23?,24-,25?/m1/s1 |
| InChIKey | VWKQIAFXBXMKLV-SATXUWQTSA-N |
| XLogP | 4.85 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|