About 2,2-difluoro-1-morpholin-4-yl-2-[4-(trimethyl-λ4-sulfanyl)phenyl]ethanone
2,2-difluoro-1-morpholin-4-yl-2-[4-(trimethyl-λ4-sulfanyl)phenyl]ethanone (PubChem CID 126703479) has the molecular formula C15H21F2NO2S
and a molecular weight of 317.40 g/mol. Its IUPAC name is 2,2-difluoro-1-morpholin-4-yl-2-[4-(trimethyl-λ4-sulfanyl)phenyl]ethanone.
Molecular Properties
| Compound Name | 2,2-difluoro-1-morpholin-4-yl-2-[4-(trimethyl-λ4-sulfanyl)phenyl]ethanone |
| PubChem CID | 126703479 |
| Molecular Formula | C15H21F2NO2S |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2,2-difluoro-1-morpholin-4-yl-2-[4-(trimethyl-λ4-sulfanyl)phenyl]ethanone |
| SMILES | CS(C)(C)c1ccc(C(F)(F)C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C15H21F2NO2S/c1-21(2,3)13-6-4-12(5-7-13)15(16,17)14(19)18-8-10-20-11-9-18/h4-7H,8-11H2,1-3H3 |
| InChIKey | UCCSSALLTZGFHN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-difluoro-1-morpholin-4-yl-2-[4-(trimethyl-λ4-sulfanyl)phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-1-morpholin-4-yl-2-[4-(trimethyl-λ4-sulfanyl)phenyl]ethanone?
The IUPAC name of 2,2-difluoro-1-morpholin-4-yl-2-[4-(trimethyl-λ4-sulfanyl)phenyl]ethanone (CID 126703479) is 2,2-difluoro-1-morpholin-4-yl-2-[4-(trimethyl-λ4-sulfanyl)phenyl]ethanone.
What is the SMILES notation for 2,2-difluoro-1-morpholin-4-yl-2-[4-(trimethyl-λ4-sulfanyl)phenyl]ethanone?
The canonical SMILES for 2,2-difluoro-1-morpholin-4-yl-2-[4-(trimethyl-λ4-sulfanyl)phenyl]ethanone is CS(C)(C)c1ccc(C(F)(F)C(=O)N2CCOCC2)cc1.
What is the InChIKey of 2,2-difluoro-1-morpholin-4-yl-2-[4-(trimethyl-λ4-sulfanyl)phenyl]ethanone?
The InChIKey is UCCSSALLTZGFHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21F2NO2S/c1-21(2,3)13-6-4-12(5-7-13)15(16,17)14(19)18-8-10-20-11-9-18/h4-7H,8-11H2,1-3H3.
What are the key properties of 2,2-difluoro-1-morpholin-4-yl-2-[4-(trimethyl-λ4-sulfanyl)phenyl]ethanone?
2,2-difluoro-1-morpholin-4-yl-2-[4-(trimethyl-λ4-sulfanyl)phenyl]ethanone has a molecular weight of 317.40 g/mol, XLogP of 2.69, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-1-morpholin-4-yl-2-[4-(trimethyl-λ4-sulfanyl)phenyl]ethanone is sourced from PubChem (CID 126703479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).