C28H43N3O4 — CID 126704495
[(6S,7S,9E,12R)-7-methyl-2-oxo-12-[(2S)-1-(4-pentyltriazol-1-yl)propan-2-yl]-1-oxacyclododec-9-en-6-yl] (2E)-4-methylpenta-2,4-dienoate (PubChem CID 126704495) has the molecular formula C28H43N3O4 and a molecular weight of 485.67 g/mol. Its IUPAC name is [(6S,7S,9E,12R)-7-methyl-2-oxo-12-[(2S)-1-(4-pentyltriazol-1-yl)propan-2-yl]-1-oxacyclododec-9-en-6-yl] (2E)-4-methylpenta-2,4-dienoate.
| Compound Name | [(6S,7S,9E,12R)-7-methyl-2-oxo-12-[(2S)-1-(4-pentyltriazol-1-yl)propan-2-yl]-1-oxacyclododec-9-en-6-yl] (2E)-4-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 126704495 |
| Molecular Formula | C28H43N3O4 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.33 |
| IUPAC Name | [(6S,7S,9E,12R)-7-methyl-2-oxo-12-[(2S)-1-(4-pentyltriazol-1-yl)propan-2-yl]-1-oxacyclododec-9-en-6-yl] (2E)-4-methylpenta-2,4-dienoate |
| SMILES | C=C(C)/C=C/C(=O)O[C@H]1CCCC(=O)O[C@@H]([C@@H](C)Cn2cc(CCCCC)nn2)C/C=C/CC1C |
| InChI | InChI=1S/C28H43N3O4/c1-6-7-8-13-24-20-31(30-29-24)19-23(5)26-14-10-9-12-22(4)25(15-11-16-27(32)35-26)34-28(33)18-17-21(2)3/h9-10,17-18,20,22-23,25-26H,2,6-8,11-16,19H2,1,3-5H3/b10-9+,18-17+/t22?,23-,25-,26+/m0/s1 |
| InChIKey | RDGFCGYQONQJEV-AROCFESHSA-N |
| XLogP | 5.76 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|