C23H36O3 — CID 126704600
ethyl (2E,4E,6E,8E,10E,12R,13S)-12-hydroxy-4,6,10,13,15-pentamethylhexadeca-2,4,6,8,10-pentaenoate (PubChem CID 126704600) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8E,10E,12R,13S)-12-hydroxy-4,6,10,13,15-pentamethylhexadeca-2,4,6,8,10-pentaenoate.
| Compound Name | ethyl (2E,4E,6E,8E,10E,12R,13S)-12-hydroxy-4,6,10,13,15-pentamethylhexadeca-2,4,6,8,10-pentaenoate |
|---|---|
| PubChem CID | 126704600 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | ethyl (2E,4E,6E,8E,10E,12R,13S)-12-hydroxy-4,6,10,13,15-pentamethylhexadeca-2,4,6,8,10-pentaenoate |
| SMILES | CCOC(=O)/C=C/C(C)=C/C(C)=C/C=C/C(C)=C/[C@H](O)[C@@H](C)CC(C)C |
| InChI | InChI=1S/C23H36O3/c1-8-26-23(25)13-12-20(6)15-18(4)10-9-11-19(5)16-22(24)21(7)14-17(2)3/h9-13,15-17,21-22,24H,8,14H2,1-7H3/b11-9+,13-12+,18-10+,19-16+,20-15+/t21-,22-/m0/s1 |
| InChIKey | DFTPHJUPBLDHFS-LLVXGMOBSA-N |
| XLogP | 5.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|