About (5E,6E)-1-methyl-5,6-bis(prop-2-enylidene)pyrazin-2-one
(5E,6E)-1-methyl-5,6-bis(prop-2-enylidene)pyrazin-2-one (PubChem CID 126704692) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is (5E,6E)-1-methyl-5,6-bis(prop-2-enylidene)pyrazin-2-one.
Molecular Properties
| Compound Name | (5E,6E)-1-methyl-5,6-bis(prop-2-enylidene)pyrazin-2-one |
| PubChem CID | 126704692 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (5E,6E)-1-methyl-5,6-bis(prop-2-enylidene)pyrazin-2-one |
| SMILES | C=C/C=c1/ncc(=O)n(C)/c1=C/C=C |
| InChI | InChI=1S/C11H12N2O/c1-4-6-9-10(7-5-2)13(3)11(14)8-12-9/h4-8H,1-2H2,3H3/b9-6+,10-7+ |
| InChIKey | ADJVSAUBEBAZNV-KZZDLZNXSA-N |
| XLogP | -0.29 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5E,6E)-1-methyl-5,6-bis(prop-2-enylidene)pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E,6E)-1-methyl-5,6-bis(prop-2-enylidene)pyrazin-2-one?
The IUPAC name of (5E,6E)-1-methyl-5,6-bis(prop-2-enylidene)pyrazin-2-one (CID 126704692) is (5E,6E)-1-methyl-5,6-bis(prop-2-enylidene)pyrazin-2-one.
What is the SMILES notation for (5E,6E)-1-methyl-5,6-bis(prop-2-enylidene)pyrazin-2-one?
The canonical SMILES for (5E,6E)-1-methyl-5,6-bis(prop-2-enylidene)pyrazin-2-one is C=C/C=c1/ncc(=O)n(C)/c1=C/C=C.
What is the InChIKey of (5E,6E)-1-methyl-5,6-bis(prop-2-enylidene)pyrazin-2-one?
The InChIKey is ADJVSAUBEBAZNV-KZZDLZNXSA-N. The full InChI is InChI=1S/C11H12N2O/c1-4-6-9-10(7-5-2)13(3)11(14)8-12-9/h4-8H,1-2H2,3H3/b9-6+,10-7+.
What are the key properties of (5E,6E)-1-methyl-5,6-bis(prop-2-enylidene)pyrazin-2-one?
(5E,6E)-1-methyl-5,6-bis(prop-2-enylidene)pyrazin-2-one has a molecular weight of 188.23 g/mol, XLogP of -0.29, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5E,6E)-1-methyl-5,6-bis(prop-2-enylidene)pyrazin-2-one is sourced from PubChem (CID 126704692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).