C17H22N4O3 — CID 126705560
3-[2-amino-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-1,3-oxazinan-2-one (PubChem CID 126705560) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 3-[2-amino-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-1,3-oxazinan-2-one.
| Compound Name | 3-[2-amino-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 126705560 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 3-[2-amino-1-(oxan-4-ylmethyl)benzimidazol-5-yl]-1,3-oxazinan-2-one |
| SMILES | Nc1nc2cc(N3CCCOC3=O)ccc2n1CC1CCOCC1 |
| InChI | InChI=1S/C17H22N4O3/c18-16-19-14-10-13(20-6-1-7-24-17(20)22)2-3-15(14)21(16)11-12-4-8-23-9-5-12/h2-3,10,12H,1,4-9,11H2,(H2,18,19) |
| InChIKey | WOLCWWGSQCYZNJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |