C26H49N5O3S2 — CID 126705962
N-[5-[(E)-(1-amino-4,5,6,7,8-pentaethyl-9-methylundecylidene)amino]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 126705962) has the molecular formula C26H49N5O3S2 and a molecular weight of 543.84 g/mol. Its IUPAC name is N-[5-[(E)-(1-amino-4,5,6,7,8-pentaethyl-9-methylundecylidene)amino]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[(E)-(1-amino-4,5,6,7,8-pentaethyl-9-methylundecylidene)amino]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 126705962 |
| Molecular Formula | C26H49N5O3S2 |
| Molecular Weight | 543.84 g/mol |
| Exact Mass | 543.33 |
| IUPAC Name | N-[5-[(E)-(1-amino-4,5,6,7,8-pentaethyl-9-methylundecylidene)amino]sulfonyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CCC(C)C(CC)C(CC)C(CC)C(CC)C(CC)CC/C(N)=N\S(=O)(=O)c1nnc(NC(C)=O)s1 |
| InChI | InChI=1S/C26H49N5O3S2/c1-9-17(7)20(11-3)22(13-5)23(14-6)21(12-4)19(10-2)15-16-24(27)31-36(33,34)26-30-29-25(35-26)28-18(8)32/h17,19-23H,9-16H2,1-8H3,(H2,27,31)(H,28,29,32) |
| InChIKey | RCEMOMFOWMURFC-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 127.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.84 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|