C10H11F12O3P — CID 126706293
2-[bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phosphoryl]-2-methylpropane (PubChem CID 126706293) has the molecular formula C10H11F12O3P and a molecular weight of 438.15 g/mol. Its IUPAC name is 2-[bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phosphoryl]-2-methylpropane.
| Compound Name | 2-[bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phosphoryl]-2-methylpropane |
|---|---|
| PubChem CID | 126706293 |
| Molecular Formula | C10H11F12O3P |
| Molecular Weight | 438.15 g/mol |
| Exact Mass | 438.03 |
| IUPAC Name | 2-[bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phosphoryl]-2-methylpropane |
| SMILES | CC(C)(C)P(=O)(OC(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H11F12O3P/c1-6(2,3)26(23,24-4(7(11,12)13)8(14,15)16)25-5(9(17,18)19)10(20,21)22/h4-5H,1-3H3 |
| InChIKey | JSYGUUBJYIBSGX-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.15 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|