About trimethyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]oxysilane
trimethyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]oxysilane (PubChem CID 12670635) has the molecular formula C9H18OSi
and a molecular weight of 170.33 g/mol. Its IUPAC name is trimethyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]oxysilane.
Molecular Properties
| Compound Name | trimethyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]oxysilane |
| PubChem CID | 12670635 |
| Molecular Formula | C9H18OSi |
| Molecular Weight | 170.33 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | trimethyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]oxysilane |
| SMILES | C=C(C)/C=C(/C)O[Si](C)(C)C |
| InChI | InChI=1S/C9H18OSi/c1-8(2)7-9(3)10-11(4,5)6/h7H,1H2,2-6H3/b9-7- |
| InChIKey | WZDWUKOGKBYCFV-CLFYSBASSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]oxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]oxysilane?
The IUPAC name of trimethyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]oxysilane (CID 12670635) is trimethyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]oxysilane.
What is the SMILES notation for trimethyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]oxysilane?
The canonical SMILES for trimethyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]oxysilane is C=C(C)/C=C(/C)O[Si](C)(C)C.
What is the InChIKey of trimethyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]oxysilane?
The InChIKey is WZDWUKOGKBYCFV-CLFYSBASSA-N. The full InChI is InChI=1S/C9H18OSi/c1-8(2)7-9(3)10-11(4,5)6/h7H,1H2,2-6H3/b9-7-.
What are the key properties of trimethyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]oxysilane?
trimethyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]oxysilane has a molecular weight of 170.33 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[(2Z)-4-methylpenta-2,4-dien-2-yl]oxysilane is sourced from PubChem (CID 12670635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).