C21H25ClN6O — CID 126706475
7-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-1-(4-chlorophenyl)-N,4-dimethyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide (PubChem CID 126706475) has the molecular formula C21H25ClN6O and a molecular weight of 412.93 g/mol. Its IUPAC name is 7-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-1-(4-chlorophenyl)-N,4-dimethyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide.
| Compound Name | 7-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-1-(4-chlorophenyl)-N,4-dimethyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 126706475 |
| Molecular Formula | C21H25ClN6O |
| Molecular Weight | 412.93 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 7-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-1-(4-chlorophenyl)-N,4-dimethyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
| SMILES | CNC(=O)N1N=C(c2ccc(Cl)cc2)c2ccc(/C(N)=C/N(C)N)cc2CC1C |
| InChI | InChI=1S/C21H25ClN6O/c1-13-10-16-11-15(19(23)12-27(3)24)6-9-18(16)20(26-28(13)21(29)25-2)14-4-7-17(22)8-5-14/h4-9,11-13H,10,23-24H2,1-3H3,(H,25,29)/b19-12- |
| InChIKey | RQDBFTAXOSZNAC-UNOMPAQXSA-N |
| XLogP | 2.74 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.93 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|