C17H29NO — CID 126706515
N-(3-cyclohexa-1,5-dien-1-yloxypropyl)-2,4-dimethylhex-5-en-2-amine (PubChem CID 126706515) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is N-(3-cyclohexa-1,5-dien-1-yloxypropyl)-2,4-dimethylhex-5-en-2-amine.
| Compound Name | N-(3-cyclohexa-1,5-dien-1-yloxypropyl)-2,4-dimethylhex-5-en-2-amine |
|---|---|
| PubChem CID | 126706515 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | N-(3-cyclohexa-1,5-dien-1-yloxypropyl)-2,4-dimethylhex-5-en-2-amine |
| SMILES | C=CC(C)CC(C)(C)NCCCOC1=CCCC=C1 |
| InChI | InChI=1S/C17H29NO/c1-5-15(2)14-17(3,4)18-12-9-13-19-16-10-7-6-8-11-16/h5,7,10-11,15,18H,1,6,8-9,12-14H2,2-4H3 |
| InChIKey | YLIZTWYNCQHLQG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|