About 5-[ethyl(methyl)amino]-5,6-dihydro-1,9-phenanthrolin-6-ol
5-[ethyl(methyl)amino]-5,6-dihydro-1,9-phenanthrolin-6-ol (PubChem CID 126706633) has the molecular formula C15H17N3O
and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-[ethyl(methyl)amino]-5,6-dihydro-1,9-phenanthrolin-6-ol.
Molecular Properties
| Compound Name | 5-[ethyl(methyl)amino]-5,6-dihydro-1,9-phenanthrolin-6-ol |
| PubChem CID | 126706633 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 5-[ethyl(methyl)amino]-5,6-dihydro-1,9-phenanthrolin-6-ol |
| SMILES | CCN(C)C1c2cccnc2-c2cnccc2C1O |
| InChI | InChI=1S/C15H17N3O/c1-3-18(2)14-11-5-4-7-17-13(11)12-9-16-8-6-10(12)15(14)19/h4-9,14-15,19H,3H2,1-2H3 |
| InChIKey | HIMUAJRPQXLAJJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[ethyl(methyl)amino]-5,6-dihydro-1,9-phenanthrolin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[ethyl(methyl)amino]-5,6-dihydro-1,9-phenanthrolin-6-ol?
The IUPAC name of 5-[ethyl(methyl)amino]-5,6-dihydro-1,9-phenanthrolin-6-ol (CID 126706633) is 5-[ethyl(methyl)amino]-5,6-dihydro-1,9-phenanthrolin-6-ol.
What is the SMILES notation for 5-[ethyl(methyl)amino]-5,6-dihydro-1,9-phenanthrolin-6-ol?
The canonical SMILES for 5-[ethyl(methyl)amino]-5,6-dihydro-1,9-phenanthrolin-6-ol is CCN(C)C1c2cccnc2-c2cnccc2C1O.
What is the InChIKey of 5-[ethyl(methyl)amino]-5,6-dihydro-1,9-phenanthrolin-6-ol?
The InChIKey is HIMUAJRPQXLAJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O/c1-3-18(2)14-11-5-4-7-17-13(11)12-9-16-8-6-10(12)15(14)19/h4-9,14-15,19H,3H2,1-2H3.
What are the key properties of 5-[ethyl(methyl)amino]-5,6-dihydro-1,9-phenanthrolin-6-ol?
5-[ethyl(methyl)amino]-5,6-dihydro-1,9-phenanthrolin-6-ol has a molecular weight of 255.32 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[ethyl(methyl)amino]-5,6-dihydro-1,9-phenanthrolin-6-ol is sourced from PubChem (CID 126706633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).