About (Z)-4-tert-butyl-N,2,2-trimethylhex-4-en-3-imine
(Z)-4-tert-butyl-N,2,2-trimethylhex-4-en-3-imine (PubChem CID 126706659) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is (Z)-4-tert-butyl-N,2,2-trimethylhex-4-en-3-imine.
Molecular Properties
| Compound Name | (Z)-4-tert-butyl-N,2,2-trimethylhex-4-en-3-imine |
| PubChem CID | 126706659 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (Z)-4-tert-butyl-N,2,2-trimethylhex-4-en-3-imine |
| SMILES | C/C=C(C(=N\C)\C(C)(C)C)/C(C)(C)C |
| InChI | InChI=1S/C13H25N/c1-9-10(12(2,3)4)11(14-8)13(5,6)7/h9H,1-8H3/b10-9+,14-11- |
| InChIKey | KSNMLZCOPQHCHM-POLRJCGMSA-N |
| XLogP | 4.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-tert-butyl-N,2,2-trimethylhex-4-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-tert-butyl-N,2,2-trimethylhex-4-en-3-imine?
The IUPAC name of (Z)-4-tert-butyl-N,2,2-trimethylhex-4-en-3-imine (CID 126706659) is (Z)-4-tert-butyl-N,2,2-trimethylhex-4-en-3-imine.
What is the SMILES notation for (Z)-4-tert-butyl-N,2,2-trimethylhex-4-en-3-imine?
The canonical SMILES for (Z)-4-tert-butyl-N,2,2-trimethylhex-4-en-3-imine is C/C=C(C(=N\C)\C(C)(C)C)/C(C)(C)C.
What is the InChIKey of (Z)-4-tert-butyl-N,2,2-trimethylhex-4-en-3-imine?
The InChIKey is KSNMLZCOPQHCHM-POLRJCGMSA-N. The full InChI is InChI=1S/C13H25N/c1-9-10(12(2,3)4)11(14-8)13(5,6)7/h9H,1-8H3/b10-9+,14-11-.
What are the key properties of (Z)-4-tert-butyl-N,2,2-trimethylhex-4-en-3-imine?
(Z)-4-tert-butyl-N,2,2-trimethylhex-4-en-3-imine has a molecular weight of 195.35 g/mol, XLogP of 4.10, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-tert-butyl-N,2,2-trimethylhex-4-en-3-imine is sourced from PubChem (CID 126706659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).