C34H24N4 — CID 126706834
4-cyclohexa-2,4-dien-1-yl-2,8,10-triphenylpyrimido[4,5-f]quinazoline (PubChem CID 126706834) has the molecular formula C34H24N4 and a molecular weight of 488.59 g/mol. Its IUPAC name is 4-cyclohexa-2,4-dien-1-yl-2,8,10-triphenylpyrimido[4,5-f]quinazoline.
| Compound Name | 4-cyclohexa-2,4-dien-1-yl-2,8,10-triphenylpyrimido[4,5-f]quinazoline |
|---|---|
| PubChem CID | 126706834 |
| Molecular Formula | C34H24N4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 4-cyclohexa-2,4-dien-1-yl-2,8,10-triphenylpyrimido[4,5-f]quinazoline |
| SMILES | C1=CCC(c2nc(-c3ccccc3)nc3c2ccc2nc(-c4ccccc4)nc(-c4ccccc4)c23)C=C1 |
| InChI | InChI=1S/C34H24N4/c1-5-13-23(14-6-1)30-27-21-22-28-29(32(27)38-34(36-30)26-19-11-4-12-20-26)31(24-15-7-2-8-16-24)37-33(35-28)25-17-9-3-10-18-25/h1-13,15-23H,14H2 |
| InChIKey | VCFBIIZGZUCNHR-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|