About (2E,6Z)-5-methyl-6-propyl-4,5-dihydroazocine
(2E,6Z)-5-methyl-6-propyl-4,5-dihydroazocine (PubChem CID 126707041) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is (2E,6Z)-5-methyl-6-propyl-4,5-dihydroazocine.
Molecular Properties
| Compound Name | (2E,6Z)-5-methyl-6-propyl-4,5-dihydroazocine |
| PubChem CID | 126707041 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (2E,6Z)-5-methyl-6-propyl-4,5-dihydroazocine |
| SMILES | CCC/C1=C/C=N\C=C/CC1C |
| InChI | InChI=1S/C11H17N/c1-3-5-11-7-9-12-8-4-6-10(11)2/h4,7-10H,3,5-6H2,1-2H3/b8-4-,11-7-,12-9- |
| InChIKey | MMJAOMOGXPUVAY-RUFBHACFSA-N |
| XLogP | 3.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2E,6Z)-5-methyl-6-propyl-4,5-dihydroazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,6Z)-5-methyl-6-propyl-4,5-dihydroazocine?
The IUPAC name of (2E,6Z)-5-methyl-6-propyl-4,5-dihydroazocine (CID 126707041) is (2E,6Z)-5-methyl-6-propyl-4,5-dihydroazocine.
What is the SMILES notation for (2E,6Z)-5-methyl-6-propyl-4,5-dihydroazocine?
The canonical SMILES for (2E,6Z)-5-methyl-6-propyl-4,5-dihydroazocine is CCC/C1=C/C=N\C=C/CC1C.
What is the InChIKey of (2E,6Z)-5-methyl-6-propyl-4,5-dihydroazocine?
The InChIKey is MMJAOMOGXPUVAY-RUFBHACFSA-N. The full InChI is InChI=1S/C11H17N/c1-3-5-11-7-9-12-8-4-6-10(11)2/h4,7-10H,3,5-6H2,1-2H3/b8-4-,11-7-,12-9-.
What are the key properties of (2E,6Z)-5-methyl-6-propyl-4,5-dihydroazocine?
(2E,6Z)-5-methyl-6-propyl-4,5-dihydroazocine has a molecular weight of 163.26 g/mol, XLogP of 3.34, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,6Z)-5-methyl-6-propyl-4,5-dihydroazocine is sourced from PubChem (CID 126707041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).