About 8-amino-3,6-bis(sulfanyl)naphthalen-1-ol
8-amino-3,6-bis(sulfanyl)naphthalen-1-ol (PubChem CID 126707077) has the molecular formula C10H9NOS2
and a molecular weight of 223.32 g/mol. Its IUPAC name is 8-amino-3,6-bis(sulfanyl)naphthalen-1-ol.
Molecular Properties
| Compound Name | 8-amino-3,6-bis(sulfanyl)naphthalen-1-ol |
| PubChem CID | 126707077 |
| Molecular Formula | C10H9NOS2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | 8-amino-3,6-bis(sulfanyl)naphthalen-1-ol |
| SMILES | Nc1cc(S)cc2cc(S)cc(O)c12 |
| InChI | InChI=1S/C10H9NOS2/c11-8-3-6(13)1-5-2-7(14)4-9(12)10(5)8/h1-4,12-14H,11H2 |
| InChIKey | MJPXFHGDZZGQPV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-3,6-bis(sulfanyl)naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-3,6-bis(sulfanyl)naphthalen-1-ol?
The IUPAC name of 8-amino-3,6-bis(sulfanyl)naphthalen-1-ol (CID 126707077) is 8-amino-3,6-bis(sulfanyl)naphthalen-1-ol.
What is the SMILES notation for 8-amino-3,6-bis(sulfanyl)naphthalen-1-ol?
The canonical SMILES for 8-amino-3,6-bis(sulfanyl)naphthalen-1-ol is Nc1cc(S)cc2cc(S)cc(O)c12.
What is the InChIKey of 8-amino-3,6-bis(sulfanyl)naphthalen-1-ol?
The InChIKey is MJPXFHGDZZGQPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NOS2/c11-8-3-6(13)1-5-2-7(14)4-9(12)10(5)8/h1-4,12-14H,11H2.
What are the key properties of 8-amino-3,6-bis(sulfanyl)naphthalen-1-ol?
8-amino-3,6-bis(sulfanyl)naphthalen-1-ol has a molecular weight of 223.32 g/mol, XLogP of 2.70, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-3,6-bis(sulfanyl)naphthalen-1-ol is sourced from PubChem (CID 126707077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).