About (6Z)-6-propyl-4,5-dihydro-3H-azocin-2-one
(6Z)-6-propyl-4,5-dihydro-3H-azocin-2-one (PubChem CID 126707093) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is (6Z)-6-propyl-4,5-dihydro-3H-azocin-2-one.
Molecular Properties
| Compound Name | (6Z)-6-propyl-4,5-dihydro-3H-azocin-2-one |
| PubChem CID | 126707093 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (6Z)-6-propyl-4,5-dihydro-3H-azocin-2-one |
| SMILES | CCC/C1=C/C=N\C(=O)CCC1 |
| InChI | InChI=1S/C10H15NO/c1-2-4-9-5-3-6-10(12)11-8-7-9/h7-8H,2-6H2,1H3/b9-7-,11-8- |
| InChIKey | CQFNPHOENDMQKO-JLUCNAMBSA-N |
| XLogP | 2.49 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6Z)-6-propyl-4,5-dihydro-3H-azocin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-6-propyl-4,5-dihydro-3H-azocin-2-one?
The IUPAC name of (6Z)-6-propyl-4,5-dihydro-3H-azocin-2-one (CID 126707093) is (6Z)-6-propyl-4,5-dihydro-3H-azocin-2-one.
What is the SMILES notation for (6Z)-6-propyl-4,5-dihydro-3H-azocin-2-one?
The canonical SMILES for (6Z)-6-propyl-4,5-dihydro-3H-azocin-2-one is CCC/C1=C/C=N\C(=O)CCC1.
What is the InChIKey of (6Z)-6-propyl-4,5-dihydro-3H-azocin-2-one?
The InChIKey is CQFNPHOENDMQKO-JLUCNAMBSA-N. The full InChI is InChI=1S/C10H15NO/c1-2-4-9-5-3-6-10(12)11-8-7-9/h7-8H,2-6H2,1H3/b9-7-,11-8-.
What are the key properties of (6Z)-6-propyl-4,5-dihydro-3H-azocin-2-one?
(6Z)-6-propyl-4,5-dihydro-3H-azocin-2-one has a molecular weight of 165.24 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-6-propyl-4,5-dihydro-3H-azocin-2-one is sourced from PubChem (CID 126707093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).