C10H16F2O — CID 126707361
(1R)-2,3-difluoro-1-methyl-4-prop-2-enoxycyclohexane (PubChem CID 126707361) has the molecular formula C10H16F2O and a molecular weight of 190.23 g/mol. Its IUPAC name is (1R)-2,3-difluoro-1-methyl-4-prop-2-enoxycyclohexane.
| Compound Name | (1R)-2,3-difluoro-1-methyl-4-prop-2-enoxycyclohexane |
|---|---|
| PubChem CID | 126707361 |
| Molecular Formula | C10H16F2O |
| Molecular Weight | 190.23 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (1R)-2,3-difluoro-1-methyl-4-prop-2-enoxycyclohexane |
| SMILES | C=CCOC1CC[C@@H](C)C(F)C1F |
| InChI | InChI=1S/C10H16F2O/c1-3-6-13-8-5-4-7(2)9(11)10(8)12/h3,7-10H,1,4-6H2,2H3/t7-,8?,9?,10?/m1/s1 |
| InChIKey | NMTJHVPKEOLWAS-QVNBGCGHSA-N |
| XLogP | 2.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|