C20H43NOS2 — CID 126707640
5-[4-[methoxy(propan-2-yl)amino]-2,2,4-trimethylpentyl]sulfanyl-2,4,4-trimethylpentane-2-thiol (PubChem CID 126707640) has the molecular formula C20H43NOS2 and a molecular weight of 377.70 g/mol. Its IUPAC name is 5-[4-[methoxy(propan-2-yl)amino]-2,2,4-trimethylpentyl]sulfanyl-2,4,4-trimethylpentane-2-thiol.
| Compound Name | 5-[4-[methoxy(propan-2-yl)amino]-2,2,4-trimethylpentyl]sulfanyl-2,4,4-trimethylpentane-2-thiol |
|---|---|
| PubChem CID | 126707640 |
| Molecular Formula | C20H43NOS2 |
| Molecular Weight | 377.70 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | 5-[4-[methoxy(propan-2-yl)amino]-2,2,4-trimethylpentyl]sulfanyl-2,4,4-trimethylpentane-2-thiol |
| SMILES | CON(C(C)C)C(C)(C)CC(C)(C)CSCC(C)(C)CC(C)(C)S |
| InChI | InChI=1S/C20H43NOS2/c1-16(2)21(22-11)19(7,8)12-17(3,4)14-24-15-18(5,6)13-20(9,10)23/h16,23H,12-15H2,1-11H3 |
| InChIKey | IKROHVHLJDQOSB-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.70 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|