C7H14FNO2S — CID 126707951
2-fluoro-N-[(2R)-1-hydroxy-3-methylsulfanylbutan-2-yl]acetamide (PubChem CID 126707951) has the molecular formula C7H14FNO2S and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-fluoro-N-[(2R)-1-hydroxy-3-methylsulfanylbutan-2-yl]acetamide.
| Compound Name | 2-fluoro-N-[(2R)-1-hydroxy-3-methylsulfanylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 126707951 |
| Molecular Formula | C7H14FNO2S |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 2-fluoro-N-[(2R)-1-hydroxy-3-methylsulfanylbutan-2-yl]acetamide |
| SMILES | CSC(C)[C@@H](CO)NC(=O)CF |
| InChI | InChI=1S/C7H14FNO2S/c1-5(12-2)6(4-10)9-7(11)3-8/h5-6,10H,3-4H2,1-2H3,(H,9,11)/t5?,6-/m1/s1 |
| InChIKey | CJHOBKRJOOAQBY-PRJDIBJQSA-N |
| XLogP | 0.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |