C18H29N — CID 126708128
2,5-bis(2,2-dimethylpropyl)-2,3-dihydro-1H-indole (PubChem CID 126708128) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is 2,5-bis(2,2-dimethylpropyl)-2,3-dihydro-1H-indole.
| Compound Name | 2,5-bis(2,2-dimethylpropyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 126708128 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 2,5-bis(2,2-dimethylpropyl)-2,3-dihydro-1H-indole |
| SMILES | CC(C)(C)Cc1ccc2c(c1)CC(CC(C)(C)C)N2 |
| InChI | InChI=1S/C18H29N/c1-17(2,3)11-13-7-8-16-14(9-13)10-15(19-16)12-18(4,5)6/h7-9,15,19H,10-12H2,1-6H3 |
| InChIKey | JBBFDZSBDKMMID-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |