C14H14N2O2S — CID 12670821
10λ6-thia-16,17-diazatricyclo[10.3.1.14,8]heptadeca-1(16),4(17),5,7,12,14-hexaene 10,10-dioxide (PubChem CID 12670821) has the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. Its IUPAC name is 10λ6-thia-16,17-diazatricyclo[10.3.1.14,8]heptadeca-1(16),4(17),5,7,12,14-hexaene 10,10-dioxide.
| Compound Name | 10λ6-thia-16,17-diazatricyclo[10.3.1.14,8]heptadeca-1(16),4(17),5,7,12,14-hexaene 10,10-dioxide |
|---|---|
| PubChem CID | 12670821 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 10λ6-thia-16,17-diazatricyclo[10.3.1.14,8]heptadeca-1(16),4(17),5,7,12,14-hexaene 10,10-dioxide |
| SMILES | O=S1(=O)Cc2cccc(n2)CCc2cccc(n2)C1 |
| InChI | InChI=1S/C14H14N2O2S/c17-19(18)9-13-5-1-3-11(15-13)7-8-12-4-2-6-14(10-19)16-12/h1-6H,7-10H2 |
| InChIKey | PQDFAGQQKNXEHL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |