C14H25N3O5S — CID 126708421
[(2R,4R,5S,6R)-6-(dimethylcarbamoyloxymethyl)-4,5-dihydroxyoxan-2-yl] N-methylazetidine-1-carboximidothioate (PubChem CID 126708421) has the molecular formula C14H25N3O5S and a molecular weight of 347.44 g/mol. Its IUPAC name is [(2R,4R,5S,6R)-6-(dimethylcarbamoyloxymethyl)-4,5-dihydroxyoxan-2-yl] N-methylazetidine-1-carboximidothioate.
| Compound Name | [(2R,4R,5S,6R)-6-(dimethylcarbamoyloxymethyl)-4,5-dihydroxyoxan-2-yl] N-methylazetidine-1-carboximidothioate |
|---|---|
| PubChem CID | 126708421 |
| Molecular Formula | C14H25N3O5S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [(2R,4R,5S,6R)-6-(dimethylcarbamoyloxymethyl)-4,5-dihydroxyoxan-2-yl] N-methylazetidine-1-carboximidothioate |
| SMILES | C/N=C(/S[C@@H]1C[C@@H](O)[C@H](O)[C@@H](COC(=O)N(C)C)O1)N1CCC1 |
| InChI | InChI=1S/C14H25N3O5S/c1-15-13(17-5-4-6-17)23-11-7-9(18)12(19)10(22-11)8-21-14(20)16(2)3/h9-12,18-19H,4-8H2,1-3H3/b15-13+/t9-,10-,11-,12+/m1/s1 |
| InChIKey | WSIKDLUDZVCKCK-NBGYPWISSA-N |
| XLogP | -0.05 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|