C28H42O15 — CID 126708447
[(2R,3S,5R,6R)-3,5-diacetyloxy-6-methyl-6-[[(2R,3R,4R,5S)-3,4,5-triacetyloxy-6-propan-2-yloxan-2-yl]methoxy]oxan-2-yl]methyl acetate (PubChem CID 126708447) has the molecular formula C28H42O15 and a molecular weight of 618.63 g/mol. Its IUPAC name is [(2R,3S,5R,6R)-3,5-diacetyloxy-6-methyl-6-[[(2R,3R,4R,5S)-3,4,5-triacetyloxy-6-propan-2-yloxan-2-yl]methoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,5R,6R)-3,5-diacetyloxy-6-methyl-6-[[(2R,3R,4R,5S)-3,4,5-triacetyloxy-6-propan-2-yloxan-2-yl]methoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 126708447 |
| Molecular Formula | C28H42O15 |
| Molecular Weight | 618.63 g/mol |
| Exact Mass | 618.25 |
| IUPAC Name | [(2R,3S,5R,6R)-3,5-diacetyloxy-6-methyl-6-[[(2R,3R,4R,5S)-3,4,5-triacetyloxy-6-propan-2-yloxan-2-yl]methoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@](C)(OC[C@H]2OC(C(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2OC(C)=O)[C@H](OC(C)=O)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H42O15/c1-13(2)24-26(40-18(7)33)27(41-19(8)34)25(39-17(6)32)22(42-24)12-36-28(9)23(38-16(5)31)10-20(37-15(4)30)21(43-28)11-35-14(3)29/h13,20-27H,10-12H2,1-9H3/t20-,21+,22+,23+,24?,25+,26-,27-,28+/m0/s1 |
| InChIKey | LMCZJNMUIRQUST-PVTCXBKASA-N |
| XLogP | 1.15 |
| TPSA | 185.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.63 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|