About 6-[(4,4-difluoropiperidin-1-yl)methyl]-2-propan-2-yl-3,4-dihydropyridine
6-[(4,4-difluoropiperidin-1-yl)methyl]-2-propan-2-yl-3,4-dihydropyridine (PubChem CID 126709115) has the molecular formula C14H22F2N2
and a molecular weight of 256.34 g/mol. Its IUPAC name is 6-[(4,4-difluoropiperidin-1-yl)methyl]-2-propan-2-yl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 6-[(4,4-difluoropiperidin-1-yl)methyl]-2-propan-2-yl-3,4-dihydropyridine |
| PubChem CID | 126709115 |
| Molecular Formula | C14H22F2N2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 6-[(4,4-difluoropiperidin-1-yl)methyl]-2-propan-2-yl-3,4-dihydropyridine |
| SMILES | CC(C)C1=NC(CN2CCC(F)(F)CC2)=CCC1 |
| InChI | InChI=1S/C14H22F2N2/c1-11(2)13-5-3-4-12(17-13)10-18-8-6-14(15,16)7-9-18/h4,11H,3,5-10H2,1-2H3 |
| InChIKey | WVKGPHBQOSKIAP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-[(4,4-difluoropiperidin-1-yl)methyl]-2-propan-2-yl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4,4-difluoropiperidin-1-yl)methyl]-2-propan-2-yl-3,4-dihydropyridine?
The IUPAC name of 6-[(4,4-difluoropiperidin-1-yl)methyl]-2-propan-2-yl-3,4-dihydropyridine (CID 126709115) is 6-[(4,4-difluoropiperidin-1-yl)methyl]-2-propan-2-yl-3,4-dihydropyridine.
What is the SMILES notation for 6-[(4,4-difluoropiperidin-1-yl)methyl]-2-propan-2-yl-3,4-dihydropyridine?
The canonical SMILES for 6-[(4,4-difluoropiperidin-1-yl)methyl]-2-propan-2-yl-3,4-dihydropyridine is CC(C)C1=NC(CN2CCC(F)(F)CC2)=CCC1.
What is the InChIKey of 6-[(4,4-difluoropiperidin-1-yl)methyl]-2-propan-2-yl-3,4-dihydropyridine?
The InChIKey is WVKGPHBQOSKIAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F2N2/c1-11(2)13-5-3-4-12(17-13)10-18-8-6-14(15,16)7-9-18/h4,11H,3,5-10H2,1-2H3.
What are the key properties of 6-[(4,4-difluoropiperidin-1-yl)methyl]-2-propan-2-yl-3,4-dihydropyridine?
6-[(4,4-difluoropiperidin-1-yl)methyl]-2-propan-2-yl-3,4-dihydropyridine has a molecular weight of 256.34 g/mol, XLogP of 3.49, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4,4-difluoropiperidin-1-yl)methyl]-2-propan-2-yl-3,4-dihydropyridine is sourced from PubChem (CID 126709115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).