C11H2ClF7N2S2 — CID 126709818
3-chloro-2,5,6-trifluoro-4-[(2,4,5,6-tetrafluoro-3-pyridinyl)sulfanylmethylsulfanyl]pyridine (PubChem CID 126709818) has the molecular formula C11H2ClF7N2S2 and a molecular weight of 394.72 g/mol. Its IUPAC name is 3-chloro-2,5,6-trifluoro-4-[(2,4,5,6-tetrafluoro-3-pyridinyl)sulfanylmethylsulfanyl]pyridine.
| Compound Name | 3-chloro-2,5,6-trifluoro-4-[(2,4,5,6-tetrafluoro-3-pyridinyl)sulfanylmethylsulfanyl]pyridine |
|---|---|
| PubChem CID | 126709818 |
| Molecular Formula | C11H2ClF7N2S2 |
| Molecular Weight | 394.72 g/mol |
| Exact Mass | 393.92 |
| IUPAC Name | 3-chloro-2,5,6-trifluoro-4-[(2,4,5,6-tetrafluoro-3-pyridinyl)sulfanylmethylsulfanyl]pyridine |
| SMILES | Fc1nc(F)c(SCSc2c(F)c(F)nc(F)c2Cl)c(F)c1F |
| InChI | InChI=1S/C11H2ClF7N2S2/c12-2-6(5(15)10(18)20-8(2)16)22-1-23-7-3(13)4(14)9(17)21-11(7)19/h1H2 |
| InChIKey | MBKAWCXWZQBOBE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.72 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|