C11H2Cl4F4N2S2 — CID 126709819
3,5-dichloro-4-[(3,5-dichloro-2,6-difluoro-4-pyridinyl)sulfanylmethylsulfanyl]-2,6-difluoropyridine (PubChem CID 126709819) has the molecular formula C11H2Cl4F4N2S2 and a molecular weight of 444.09 g/mol. Its IUPAC name is 3,5-dichloro-4-[(3,5-dichloro-2,6-difluoro-4-pyridinyl)sulfanylmethylsulfanyl]-2,6-difluoropyridine.
| Compound Name | 3,5-dichloro-4-[(3,5-dichloro-2,6-difluoro-4-pyridinyl)sulfanylmethylsulfanyl]-2,6-difluoropyridine |
|---|---|
| PubChem CID | 126709819 |
| Molecular Formula | C11H2Cl4F4N2S2 |
| Molecular Weight | 444.09 g/mol |
| Exact Mass | 441.83 |
| IUPAC Name | 3,5-dichloro-4-[(3,5-dichloro-2,6-difluoro-4-pyridinyl)sulfanylmethylsulfanyl]-2,6-difluoropyridine |
| SMILES | Fc1nc(F)c(Cl)c(SCSc2c(Cl)c(F)nc(F)c2Cl)c1Cl |
| InChI | InChI=1S/C11H2Cl4F4N2S2/c12-2-6(3(13)9(17)20-8(2)16)22-1-23-7-4(14)10(18)21-11(19)5(7)15/h1H2 |
| InChIKey | APFGYDWTPPGEDM-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.09 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|