C10H17F3N2 — CID 126709994
1-[(Z)-4,4,4-trifluoro-2,3-dimethylbut-2-enyl]piperazine (PubChem CID 126709994) has the molecular formula C10H17F3N2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 1-[(Z)-4,4,4-trifluoro-2,3-dimethylbut-2-enyl]piperazine.
| Compound Name | 1-[(Z)-4,4,4-trifluoro-2,3-dimethylbut-2-enyl]piperazine |
|---|---|
| PubChem CID | 126709994 |
| Molecular Formula | C10H17F3N2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 1-[(Z)-4,4,4-trifluoro-2,3-dimethylbut-2-enyl]piperazine |
| SMILES | C/C(CN1CCNCC1)=C(\C)C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2/c1-8(9(2)10(11,12)13)7-15-5-3-14-4-6-15/h14H,3-7H2,1-2H3/b9-8- |
| InChIKey | KTVGNJRQRILZJB-HJWRWDBZSA-N |
| XLogP | 1.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|