C18H28N2O2 — CID 126710006
2-amino-2-(3-hydroxy-1-adamantyl)-1-(6-methyl-2-azabicyclo[3.1.0]hexan-2-yl)ethanone (PubChem CID 126710006) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-amino-2-(3-hydroxy-1-adamantyl)-1-(6-methyl-2-azabicyclo[3.1.0]hexan-2-yl)ethanone.
| Compound Name | 2-amino-2-(3-hydroxy-1-adamantyl)-1-(6-methyl-2-azabicyclo[3.1.0]hexan-2-yl)ethanone |
|---|---|
| PubChem CID | 126710006 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-amino-2-(3-hydroxy-1-adamantyl)-1-(6-methyl-2-azabicyclo[3.1.0]hexan-2-yl)ethanone |
| SMILES | CC1C2CCN(C(=O)C(N)C34CC5CC(CC(O)(C5)C3)C4)C12 |
| InChI | InChI=1S/C18H28N2O2/c1-10-13-2-3-20(14(10)13)16(21)15(19)17-5-11-4-12(6-17)8-18(22,7-11)9-17/h10-15,22H,2-9,19H2,1H3 |
| InChIKey | QUGWQEGTKOTFSJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |