C33H59N3O8S3 — CID 126710585
(4R)-4-(ethylamino)-2-(3-methoxypropyl)-N-[(5S)-3-methyl-4-oxo-5-(3,5,5,7,7-pentamethyl-4-oxononan-3-yl)oxyhexan-3-yl]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide (PubChem CID 126710585) has the molecular formula C33H59N3O8S3 and a molecular weight of 722.05 g/mol. Its IUPAC name is (4R)-4-(ethylamino)-2-(3-methoxypropyl)-N-[(5S)-3-methyl-4-oxo-5-(3,5,5,7,7-pentamethyl-4-oxononan-3-yl)oxyhexan-3-yl]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide.
| Compound Name | (4R)-4-(ethylamino)-2-(3-methoxypropyl)-N-[(5S)-3-methyl-4-oxo-5-(3,5,5,7,7-pentamethyl-4-oxononan-3-yl)oxyhexan-3-yl]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
|---|---|
| PubChem CID | 126710585 |
| Molecular Formula | C33H59N3O8S3 |
| Molecular Weight | 722.05 g/mol |
| Exact Mass | 721.35 |
| IUPAC Name | (4R)-4-(ethylamino)-2-(3-methoxypropyl)-N-[(5S)-3-methyl-4-oxo-5-(3,5,5,7,7-pentamethyl-4-oxononan-3-yl)oxyhexan-3-yl]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
| SMILES | CCN[C@H]1CN(CCCOC)S(=O)(=O)c2sc(S(=O)(=O)NC(C)(CC)C(=O)[C@H](C)OC(C)(CC)C(=O)C(C)(C)CC(C)(C)CC)cc21 |
| InChI | InChI=1S/C33H59N3O8S3/c1-13-30(6,7)22-31(8,9)29(38)33(11,15-3)44-23(5)27(37)32(10,14-2)35-46(39,40)26-20-24-25(34-16-4)21-36(18-17-19-43-12)47(41,42)28(24)45-26/h20,23,25,34-35H,13-19,21-22H2,1-12H3/t23-,25-,32?,33?/m0/s1 |
| InChIKey | DLSOELCLADJYLF-FNSPNQAZSA-N |
| XLogP | 5.45 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.05 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|