C27H49N3O7S3 — CID 126710592
(4R)-4-(ethylamino)-2-(3-methoxypropyl)-N-[(5S)-3-methyl-4-oxo-5-(2,2,3-trimethylpentan-3-yloxy)hexan-3-yl]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide (PubChem CID 126710592) has the molecular formula C27H49N3O7S3 and a molecular weight of 623.90 g/mol. Its IUPAC name is (4R)-4-(ethylamino)-2-(3-methoxypropyl)-N-[(5S)-3-methyl-4-oxo-5-(2,2,3-trimethylpentan-3-yloxy)hexan-3-yl]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide.
| Compound Name | (4R)-4-(ethylamino)-2-(3-methoxypropyl)-N-[(5S)-3-methyl-4-oxo-5-(2,2,3-trimethylpentan-3-yloxy)hexan-3-yl]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
|---|---|
| PubChem CID | 126710592 |
| Molecular Formula | C27H49N3O7S3 |
| Molecular Weight | 623.90 g/mol |
| Exact Mass | 623.27 |
| IUPAC Name | (4R)-4-(ethylamino)-2-(3-methoxypropyl)-N-[(5S)-3-methyl-4-oxo-5-(2,2,3-trimethylpentan-3-yloxy)hexan-3-yl]-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide |
| SMILES | CCN[C@H]1CN(CCCOC)S(=O)(=O)c2sc(S(=O)(=O)NC(C)(CC)C(=O)[C@H](C)OC(C)(CC)C(C)(C)C)cc21 |
| InChI | InChI=1S/C27H49N3O7S3/c1-11-26(8,23(31)19(4)37-27(9,12-2)25(5,6)7)29-39(32,33)22-17-20-21(28-13-3)18-30(15-14-16-36-10)40(34,35)24(20)38-22/h17,19,21,28-29H,11-16,18H2,1-10H3/t19-,21-,26?,27?/m0/s1 |
| InChIKey | PWORZRDLWPDAPK-IAIAEGGLSA-N |
| XLogP | 4.08 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|