C13H19NO — CID 126710965
(5E,7E,8Z)-7-[(ethylideneamino)methylidene]deca-5,8-dien-2-one (PubChem CID 126710965) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (5E,7E,8Z)-7-[(ethylideneamino)methylidene]deca-5,8-dien-2-one.
| Compound Name | (5E,7E,8Z)-7-[(ethylideneamino)methylidene]deca-5,8-dien-2-one |
|---|---|
| PubChem CID | 126710965 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (5E,7E,8Z)-7-[(ethylideneamino)methylidene]deca-5,8-dien-2-one |
| SMILES | C/C=C\C(\C=C\CCC(C)=O)=C/N=C/C |
| InChI | InChI=1S/C13H19NO/c1-4-8-13(11-14-5-2)10-7-6-9-12(3)15/h4-5,7-8,10-11H,6,9H2,1-3H3/b8-4-,10-7+,13-11+,14-5+ |
| InChIKey | GMWKLBBUWIWCPX-SDGZTTIXSA-N |
| XLogP | 3.46 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|