C17H27FO — CID 126711027
(3Z,5Z)-4-ethyl-2-(2-fluoro-2-methylbutoxy)-3-prop-1-en-2-ylhepta-1,3,5-triene (PubChem CID 126711027) has the molecular formula C17H27FO and a molecular weight of 266.40 g/mol. Its IUPAC name is (3Z,5Z)-4-ethyl-2-(2-fluoro-2-methylbutoxy)-3-prop-1-en-2-ylhepta-1,3,5-triene.
| Compound Name | (3Z,5Z)-4-ethyl-2-(2-fluoro-2-methylbutoxy)-3-prop-1-en-2-ylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 126711027 |
| Molecular Formula | C17H27FO |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | (3Z,5Z)-4-ethyl-2-(2-fluoro-2-methylbutoxy)-3-prop-1-en-2-ylhepta-1,3,5-triene |
| SMILES | C=C(C)/C(C(=C)OCC(C)(F)CC)=C(/C=C\C)CC |
| InChI | InChI=1S/C17H27FO/c1-8-11-15(9-2)16(13(4)5)14(6)19-12-17(7,18)10-3/h8,11H,4,6,9-10,12H2,1-3,5,7H3/b11-8-,16-15- |
| InChIKey | FTOVWJVVVZPRFE-IWJOUKIMSA-N |
| XLogP | 5.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|