About [(2E)-1-ethenyliminopenta-2,4-dien-2-yl] thiocyanate
[(2E)-1-ethenyliminopenta-2,4-dien-2-yl] thiocyanate (PubChem CID 126711121) has the molecular formula C8H8N2S
and a molecular weight of 164.23 g/mol. Its IUPAC name is [(2E)-1-ethenyliminopenta-2,4-dien-2-yl] thiocyanate.
Molecular Properties
| Compound Name | [(2E)-1-ethenyliminopenta-2,4-dien-2-yl] thiocyanate |
| PubChem CID | 126711121 |
| Molecular Formula | C8H8N2S |
| Molecular Weight | 164.23 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | [(2E)-1-ethenyliminopenta-2,4-dien-2-yl] thiocyanate |
| SMILES | C=C/C=C(\C=N\C=C)SC#N |
| InChI | InChI=1S/C8H8N2S/c1-3-5-8(11-7-9)6-10-4-2/h3-6H,1-2H2/b8-5+,10-6+ |
| InChIKey | CLQSGBIPHOTCJS-YLDLMLGBSA-N |
| XLogP | 2.48 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-1-ethenyliminopenta-2,4-dien-2-yl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-1-ethenyliminopenta-2,4-dien-2-yl] thiocyanate?
The IUPAC name of [(2E)-1-ethenyliminopenta-2,4-dien-2-yl] thiocyanate (CID 126711121) is [(2E)-1-ethenyliminopenta-2,4-dien-2-yl] thiocyanate.
What is the SMILES notation for [(2E)-1-ethenyliminopenta-2,4-dien-2-yl] thiocyanate?
The canonical SMILES for [(2E)-1-ethenyliminopenta-2,4-dien-2-yl] thiocyanate is C=C/C=C(\C=N\C=C)SC#N.
What is the InChIKey of [(2E)-1-ethenyliminopenta-2,4-dien-2-yl] thiocyanate?
The InChIKey is CLQSGBIPHOTCJS-YLDLMLGBSA-N. The full InChI is InChI=1S/C8H8N2S/c1-3-5-8(11-7-9)6-10-4-2/h3-6H,1-2H2/b8-5+,10-6+.
What are the key properties of [(2E)-1-ethenyliminopenta-2,4-dien-2-yl] thiocyanate?
[(2E)-1-ethenyliminopenta-2,4-dien-2-yl] thiocyanate has a molecular weight of 164.23 g/mol, XLogP of 2.48, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-1-ethenyliminopenta-2,4-dien-2-yl] thiocyanate is sourced from PubChem (CID 126711121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).