C29H37F3N4O2 — CID 126711177
N-[[3-[[(1-pentan-2-ylpiperidin-4-yl)-[[3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl]methyl]prop-2-enamide (PubChem CID 126711177) has the molecular formula C29H37F3N4O2 and a molecular weight of 530.64 g/mol. Its IUPAC name is N-[[3-[[(1-pentan-2-ylpiperidin-4-yl)-[[3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[3-[[(1-pentan-2-ylpiperidin-4-yl)-[[3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 126711177 |
| Molecular Formula | C29H37F3N4O2 |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | N-[[3-[[(1-pentan-2-ylpiperidin-4-yl)-[[3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1cccc(CN(C(=O)Nc2cccc(C(F)(F)F)c2)C2CCN(C(C)CCC)CC2)c1 |
| InChI | InChI=1S/C29H37F3N4O2/c1-4-8-21(3)35-15-13-26(14-16-35)36(20-23-10-6-9-22(17-23)19-33-27(37)5-2)28(38)34-25-12-7-11-24(18-25)29(30,31)32/h5-7,9-12,17-18,21,26H,2,4,8,13-16,19-20H2,1,3H3,(H,33,37)(H,34,38) |
| InChIKey | UYAXKQSIPIRUIU-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|