About (Z)-1-cyclopentyl-N,N-dipropylpent-1-en-1-amine
(Z)-1-cyclopentyl-N,N-dipropylpent-1-en-1-amine (PubChem CID 126711275) has the molecular formula C16H31N
and a molecular weight of 237.43 g/mol. Its IUPAC name is (Z)-1-cyclopentyl-N,N-dipropylpent-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-1-cyclopentyl-N,N-dipropylpent-1-en-1-amine |
| PubChem CID | 126711275 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | (Z)-1-cyclopentyl-N,N-dipropylpent-1-en-1-amine |
| SMILES | CCC/C=C(/C1CCCC1)N(CCC)CCC |
| InChI | InChI=1S/C16H31N/c1-4-7-12-16(15-10-8-9-11-15)17(13-5-2)14-6-3/h12,15H,4-11,13-14H2,1-3H3/b16-12- |
| InChIKey | JJIYOYOAIOCNRM-VBKFSLOCSA-N |
| XLogP | 4.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-1-cyclopentyl-N,N-dipropylpent-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-cyclopentyl-N,N-dipropylpent-1-en-1-amine?
The IUPAC name of (Z)-1-cyclopentyl-N,N-dipropylpent-1-en-1-amine (CID 126711275) is (Z)-1-cyclopentyl-N,N-dipropylpent-1-en-1-amine.
What is the SMILES notation for (Z)-1-cyclopentyl-N,N-dipropylpent-1-en-1-amine?
The canonical SMILES for (Z)-1-cyclopentyl-N,N-dipropylpent-1-en-1-amine is CCC/C=C(/C1CCCC1)N(CCC)CCC.
What is the InChIKey of (Z)-1-cyclopentyl-N,N-dipropylpent-1-en-1-amine?
The InChIKey is JJIYOYOAIOCNRM-VBKFSLOCSA-N. The full InChI is InChI=1S/C16H31N/c1-4-7-12-16(15-10-8-9-11-15)17(13-5-2)14-6-3/h12,15H,4-11,13-14H2,1-3H3/b16-12-.
What are the key properties of (Z)-1-cyclopentyl-N,N-dipropylpent-1-en-1-amine?
(Z)-1-cyclopentyl-N,N-dipropylpent-1-en-1-amine has a molecular weight of 237.43 g/mol, XLogP of 4.98, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-cyclopentyl-N,N-dipropylpent-1-en-1-amine is sourced from PubChem (CID 126711275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).