C24H32ClN4O3- — CID 126711312
1-benzyl-3-[4-chloro-3-[hydroxy(oxido)amino]phenyl]-1-(1-pentan-2-ylpiperidin-4-yl)urea (PubChem CID 126711312) has the molecular formula C24H32ClN4O3- and a molecular weight of 460.00 g/mol. Its IUPAC name is 1-benzyl-3-[4-chloro-3-[hydroxy(oxido)amino]phenyl]-1-(1-pentan-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-benzyl-3-[4-chloro-3-[hydroxy(oxido)amino]phenyl]-1-(1-pentan-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 126711312 |
| Molecular Formula | C24H32ClN4O3- |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 1-benzyl-3-[4-chloro-3-[hydroxy(oxido)amino]phenyl]-1-(1-pentan-2-ylpiperidin-4-yl)urea |
| SMILES | CCCC(C)N1CCC(N(Cc2ccccc2)C(=O)Nc2ccc(Cl)c(N([O-])O)c2)CC1 |
| InChI | InChI=1S/C24H32ClN4O3/c1-3-7-18(2)27-14-12-21(13-15-27)28(17-19-8-5-4-6-9-19)24(30)26-20-10-11-22(25)23(16-20)29(31)32/h4-6,8-11,16,18,21,31H,3,7,12-15,17H2,1-2H3,(H,26,30)/q-1 |
| InChIKey | FHNBZOPYERDRBR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|