C24H30F3N3O — CID 126711318
1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)-3-(3,4,5-trifluorophenyl)urea (PubChem CID 126711318) has the molecular formula C24H30F3N3O and a molecular weight of 433.52 g/mol. Its IUPAC name is 1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)-3-(3,4,5-trifluorophenyl)urea.
| Compound Name | 1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)-3-(3,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 126711318 |
| Molecular Formula | C24H30F3N3O |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)-3-(3,4,5-trifluorophenyl)urea |
| SMILES | CCCC(C)N1CCC(N(Cc2ccccc2)C(=O)Nc2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C24H30F3N3O/c1-3-7-17(2)29-12-10-20(11-13-29)30(16-18-8-5-4-6-9-18)24(31)28-19-14-21(25)23(27)22(26)15-19/h4-6,8-9,14-15,17,20H,3,7,10-13,16H2,1-2H3,(H,28,31) |
| InChIKey | QEBDNBFCJBJTKR-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|