About 3-(1,3-benzothiazol-6-yl)-1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)urea
3-(1,3-benzothiazol-6-yl)-1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)urea (PubChem CID 126711331) has the molecular formula C25H32N4OS
and a molecular weight of 436.63 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-6-yl)-1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)urea.
Molecular Properties
| Compound Name | 3-(1,3-benzothiazol-6-yl)-1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)urea |
| PubChem CID | 126711331 |
| Molecular Formula | C25H32N4OS |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | 3-(1,3-benzothiazol-6-yl)-1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)urea |
| SMILES | CCCC(C)N1CCC(N(Cc2ccccc2)C(=O)Nc2ccc3ncsc3c2)CC1 |
| InChI | InChI=1S/C25H32N4OS/c1-3-7-19(2)28-14-12-22(13-15-28)29(17-20-8-5-4-6-9-20)25(30)27-21-10-11-23-24(16-21)31-18-26-23/h4-6,8-11,16,18-19,22H,3,7,12-15,17H2,1-2H3,(H,27,30) |
| InChIKey | WVOMQRZSSYGPHD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,3-benzothiazol-6-yl)-1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzothiazol-6-yl)-1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)urea?
The IUPAC name of 3-(1,3-benzothiazol-6-yl)-1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)urea (CID 126711331) is 3-(1,3-benzothiazol-6-yl)-1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)urea.
What is the SMILES notation for 3-(1,3-benzothiazol-6-yl)-1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)urea?
The canonical SMILES for 3-(1,3-benzothiazol-6-yl)-1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)urea is CCCC(C)N1CCC(N(Cc2ccccc2)C(=O)Nc2ccc3ncsc3c2)CC1.
What is the InChIKey of 3-(1,3-benzothiazol-6-yl)-1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)urea?
The InChIKey is WVOMQRZSSYGPHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32N4OS/c1-3-7-19(2)28-14-12-22(13-15-28)29(17-20-8-5-4-6-9-20)25(30)27-21-10-11-23-24(16-21)31-18-26-23/h4-6,8-11,16,18-19,22H,3,7,12-15,17H2,1-2H3,(H,27,30).
What are the key properties of 3-(1,3-benzothiazol-6-yl)-1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)urea?
3-(1,3-benzothiazol-6-yl)-1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)urea has a molecular weight of 436.63 g/mol, XLogP of 5.98, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzothiazol-6-yl)-1-benzyl-1-(1-pentan-2-ylpiperidin-4-yl)urea is sourced from PubChem (CID 126711331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).