About 1-benzyl-1-(1-butylpiperidin-4-yl)-3-(3,5-difluorophenyl)urea
1-benzyl-1-(1-butylpiperidin-4-yl)-3-(3,5-difluorophenyl)urea (PubChem CID 126711369) has the molecular formula C23H29F2N3O
and a molecular weight of 401.50 g/mol. Its IUPAC name is 1-benzyl-1-(1-butylpiperidin-4-yl)-3-(3,5-difluorophenyl)urea.
Molecular Properties
| Compound Name | 1-benzyl-1-(1-butylpiperidin-4-yl)-3-(3,5-difluorophenyl)urea |
| PubChem CID | 126711369 |
| Molecular Formula | C23H29F2N3O |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 1-benzyl-1-(1-butylpiperidin-4-yl)-3-(3,5-difluorophenyl)urea |
| SMILES | CCCCN1CCC(N(Cc2ccccc2)C(=O)Nc2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C23H29F2N3O/c1-2-3-11-27-12-9-22(10-13-27)28(17-18-7-5-4-6-8-18)23(29)26-21-15-19(24)14-20(25)16-21/h4-8,14-16,22H,2-3,9-13,17H2,1H3,(H,26,29) |
| InChIKey | ZIPLARAAYQQKNP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-1-(1-butylpiperidin-4-yl)-3-(3,5-difluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-1-(1-butylpiperidin-4-yl)-3-(3,5-difluorophenyl)urea?
The IUPAC name of 1-benzyl-1-(1-butylpiperidin-4-yl)-3-(3,5-difluorophenyl)urea (CID 126711369) is 1-benzyl-1-(1-butylpiperidin-4-yl)-3-(3,5-difluorophenyl)urea.
What is the SMILES notation for 1-benzyl-1-(1-butylpiperidin-4-yl)-3-(3,5-difluorophenyl)urea?
The canonical SMILES for 1-benzyl-1-(1-butylpiperidin-4-yl)-3-(3,5-difluorophenyl)urea is CCCCN1CCC(N(Cc2ccccc2)C(=O)Nc2cc(F)cc(F)c2)CC1.
What is the InChIKey of 1-benzyl-1-(1-butylpiperidin-4-yl)-3-(3,5-difluorophenyl)urea?
The InChIKey is ZIPLARAAYQQKNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29F2N3O/c1-2-3-11-27-12-9-22(10-13-27)28(17-18-7-5-4-6-8-18)23(29)26-21-15-19(24)14-20(25)16-21/h4-8,14-16,22H,2-3,9-13,17H2,1H3,(H,26,29).
What are the key properties of 1-benzyl-1-(1-butylpiperidin-4-yl)-3-(3,5-difluorophenyl)urea?
1-benzyl-1-(1-butylpiperidin-4-yl)-3-(3,5-difluorophenyl)urea has a molecular weight of 401.50 g/mol, XLogP of 5.26, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-1-(1-butylpiperidin-4-yl)-3-(3,5-difluorophenyl)urea is sourced from PubChem (CID 126711369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).