C28H35F3N4O2 — CID 126711573
N-[3-[[(1-pentan-2-ylpiperidin-4-yl)-[[3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl]prop-2-enamide (PubChem CID 126711573) has the molecular formula C28H35F3N4O2 and a molecular weight of 516.61 g/mol. Its IUPAC name is N-[3-[[(1-pentan-2-ylpiperidin-4-yl)-[[3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[(1-pentan-2-ylpiperidin-4-yl)-[[3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126711573 |
| Molecular Formula | C28H35F3N4O2 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | N-[3-[[(1-pentan-2-ylpiperidin-4-yl)-[[3-(trifluoromethyl)phenyl]carbamoyl]amino]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CN(C(=O)Nc2cccc(C(F)(F)F)c2)C2CCN(C(C)CCC)CC2)c1 |
| InChI | InChI=1S/C28H35F3N4O2/c1-4-8-20(3)34-15-13-25(14-16-34)35(19-21-9-6-11-23(17-21)32-26(36)5-2)27(37)33-24-12-7-10-22(18-24)28(29,30)31/h5-7,9-12,17-18,20,25H,2,4,8,13-16,19H2,1,3H3,(H,32,36)(H,33,37) |
| InChIKey | LYYYSYJQVIOSIT-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|