About 4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenol
4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenol (PubChem CID 126711831) has the molecular formula C18H18O
and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenol.
Molecular Properties
| Compound Name | 4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenol |
| PubChem CID | 126711831 |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenol |
| SMILES | C/C=C\C(=C/C)c1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C18H18O/c1-3-5-14(4-2)15-6-8-16(9-7-15)17-10-12-18(19)13-11-17/h3-13,19H,1-2H3/b5-3-,14-4+ |
| InChIKey | URJCYRFKLDBDMN-NUTJIFLOSA-N |
| XLogP | 5.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenol?
The IUPAC name of 4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenol (CID 126711831) is 4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenol.
What is the SMILES notation for 4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenol?
The canonical SMILES for 4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenol is C/C=C\C(=C/C)c1ccc(-c2ccc(O)cc2)cc1.
What is the InChIKey of 4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenol?
The InChIKey is URJCYRFKLDBDMN-NUTJIFLOSA-N. The full InChI is InChI=1S/C18H18O/c1-3-5-14(4-2)15-6-8-16(9-7-15)17-10-12-18(19)13-11-17/h3-13,19H,1-2H3/b5-3-,14-4+.
What are the key properties of 4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenol?
4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenol has a molecular weight of 250.34 g/mol, XLogP of 5.04, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2E,4Z)-hexa-2,4-dien-3-yl]phenyl]phenol is sourced from PubChem (CID 126711831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).