C17H23ClFN3O — CID 126712022
[4-[(3-amino-2-chloro-5-fluorophenyl)methyl]piperazin-1-yl]-cyclopentylmethanone (PubChem CID 126712022) has the molecular formula C17H23ClFN3O and a molecular weight of 339.84 g/mol. Its IUPAC name is [4-[(3-amino-2-chloro-5-fluorophenyl)methyl]piperazin-1-yl]-cyclopentylmethanone.
| Compound Name | [4-[(3-amino-2-chloro-5-fluorophenyl)methyl]piperazin-1-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 126712022 |
| Molecular Formula | C17H23ClFN3O |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | [4-[(3-amino-2-chloro-5-fluorophenyl)methyl]piperazin-1-yl]-cyclopentylmethanone |
| SMILES | Nc1cc(F)cc(CN2CCN(C(=O)C3CCCC3)CC2)c1Cl |
| InChI | InChI=1S/C17H23ClFN3O/c18-16-13(9-14(19)10-15(16)20)11-21-5-7-22(8-6-21)17(23)12-3-1-2-4-12/h9-10,12H,1-8,11,20H2 |
| InChIKey | HFVYDQZXZKHQJB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|