C24H36O4 — CID 126712189
(9S,14S,17R)-17-butanoyl-13-ethyl-17-hydroxy-10-methyl-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,11-dione (PubChem CID 126712189) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (9S,14S,17R)-17-butanoyl-13-ethyl-17-hydroxy-10-methyl-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | (9S,14S,17R)-17-butanoyl-13-ethyl-17-hydroxy-10-methyl-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 126712189 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (9S,14S,17R)-17-butanoyl-13-ethyl-17-hydroxy-10-methyl-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,11-dione |
| SMILES | CCCC(=O)[C@@]1(O)CC[C@H]2C3CCC4CC(=O)CCC4(C)[C@H]3C(=O)CC21CC |
| InChI | InChI=1S/C24H36O4/c1-4-6-20(27)24(28)12-10-18-17-8-7-15-13-16(25)9-11-22(15,3)21(17)19(26)14-23(18,24)5-2/h15,17-18,21,28H,4-14H2,1-3H3/t15?,17?,18-,21+,22?,23?,24-/m0/s1 |
| InChIKey | KRHZNADYWNOULG-AMOTWBATSA-N |
| XLogP | 4.27 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |