C11H13N5 — CID 12671223
7-methyl-3-prop-2-enyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene (PubChem CID 12671223) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 7-methyl-3-prop-2-enyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene.
| Compound Name | 7-methyl-3-prop-2-enyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
|---|---|
| PubChem CID | 12671223 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 7-methyl-3-prop-2-enyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
| SMILES | C=CCN1CCc2c(C)nc3ncnn3c21 |
| InChI | InChI=1S/C11H13N5/c1-3-5-15-6-4-9-8(2)14-11-12-7-13-16(11)10(9)15/h3,7H,1,4-6H2,2H3 |
| InChIKey | DSGSZJVZYRJXKH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|