C18H21N5O3 — CID 12671234
7-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene (PubChem CID 12671234) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is 7-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene.
| Compound Name | 7-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
|---|---|
| PubChem CID | 12671234 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 7-methyl-3-[(3,4,5-trimethoxyphenyl)methyl]-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
| SMILES | COc1cc(CN2CCc3c(C)nc4ncnn4c32)cc(OC)c1OC |
| InChI | InChI=1S/C18H21N5O3/c1-11-13-5-6-22(17(13)23-18(21-11)19-10-20-23)9-12-7-14(24-2)16(26-4)15(8-12)25-3/h7-8,10H,5-6,9H2,1-4H3 |
| InChIKey | QRFBDXVAMLIXSY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 74.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |